About [(E)-[2-methyl-1-(3-phenylsulfanylphenyl)propylidene]amino] N-pyridin-4-ylcarbamate
[(E)-[2-methyl-1-(3-phenylsulfanylphenyl)propylidene]amino] N-pyridin-4-ylcarbamate (PubChem CID 172945275) has the molecular formula C22H21N3O2S
and a molecular weight of 391.50 g/mol. Its IUPAC name is [(E)-[2-methyl-1-(3-phenylsulfanylphenyl)propylidene]amino] N-pyridin-4-ylcarbamate.
Molecular Properties
| Compound Name | [(E)-[2-methyl-1-(3-phenylsulfanylphenyl)propylidene]amino] N-pyridin-4-ylcarbamate |
| PubChem CID | 172945275 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | [(E)-[2-methyl-1-(3-phenylsulfanylphenyl)propylidene]amino] N-pyridin-4-ylcarbamate |
| SMILES | CC(C)/C(=N\OC(=O)Nc1ccncc1)c1cccc(Sc2ccccc2)c1 |
| InChI | InChI=1S/C22H21N3O2S/c1-16(2)21(25-27-22(26)24-18-11-13-23-14-12-18)17-7-6-10-20(15-17)28-19-8-4-3-5-9-19/h3-16H,1-2H3,(H,23,24,26)/b25-21+ |
| InChIKey | NJYZSUOCLLFATH-NJNXFGOHSA-N |
| XLogP | 5.84 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[2-methyl-1-(3-phenylsulfanylphenyl)propylidene]amino] N-pyridin-4-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[2-methyl-1-(3-phenylsulfanylphenyl)propylidene]amino] N-pyridin-4-ylcarbamate?
The IUPAC name of [(E)-[2-methyl-1-(3-phenylsulfanylphenyl)propylidene]amino] N-pyridin-4-ylcarbamate (CID 172945275) is [(E)-[2-methyl-1-(3-phenylsulfanylphenyl)propylidene]amino] N-pyridin-4-ylcarbamate.
What is the SMILES notation for [(E)-[2-methyl-1-(3-phenylsulfanylphenyl)propylidene]amino] N-pyridin-4-ylcarbamate?
The canonical SMILES for [(E)-[2-methyl-1-(3-phenylsulfanylphenyl)propylidene]amino] N-pyridin-4-ylcarbamate is CC(C)/C(=N\OC(=O)Nc1ccncc1)c1cccc(Sc2ccccc2)c1.
What is the InChIKey of [(E)-[2-methyl-1-(3-phenylsulfanylphenyl)propylidene]amino] N-pyridin-4-ylcarbamate?
The InChIKey is NJYZSUOCLLFATH-NJNXFGOHSA-N. The full InChI is InChI=1S/C22H21N3O2S/c1-16(2)21(25-27-22(26)24-18-11-13-23-14-12-18)17-7-6-10-20(15-17)28-19-8-4-3-5-9-19/h3-16H,1-2H3,(H,23,24,26)/b25-21+.
What are the key properties of [(E)-[2-methyl-1-(3-phenylsulfanylphenyl)propylidene]amino] N-pyridin-4-ylcarbamate?
[(E)-[2-methyl-1-(3-phenylsulfanylphenyl)propylidene]amino] N-pyridin-4-ylcarbamate has a molecular weight of 391.50 g/mol, XLogP of 5.84, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[2-methyl-1-(3-phenylsulfanylphenyl)propylidene]amino] N-pyridin-4-ylcarbamate is sourced from PubChem (CID 172945275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).