C25H22N2O7 — CID 5099088
2,3-bis[(3-methylbenzoyl)oxy]-4-oxo-4-(pyridin-4-ylamino)butanoic acid (PubChem CID 5099088) has the molecular formula C25H22N2O7 and a molecular weight of 462.46 g/mol. Its IUPAC name is 2,3-bis[(3-methylbenzoyl)oxy]-4-oxo-4-(pyridin-4-ylamino)butanoic acid.
| Compound Name | 2,3-bis[(3-methylbenzoyl)oxy]-4-oxo-4-(pyridin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 5099088 |
| Molecular Formula | C25H22N2O7 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 2,3-bis[(3-methylbenzoyl)oxy]-4-oxo-4-(pyridin-4-ylamino)butanoic acid |
| SMILES | Cc1cccc(C(=O)OC(C(=O)O)C(OC(=O)c2cccc(C)c2)C(=O)Nc2ccncc2)c1 |
| InChI | InChI=1S/C25H22N2O7/c1-15-5-3-7-17(13-15)24(31)33-20(22(28)27-19-9-11-26-12-10-19)21(23(29)30)34-25(32)18-8-4-6-16(2)14-18/h3-14,20-21H,1-2H3,(H,29,30)(H,26,27,28) |
| InChIKey | UAZNVBLAJWTORR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |