C27H22F3NO7 — CID 126388147
(2R,3R)-2,3-bis[(3-methylbenzoyl)oxy]-4-oxo-4-[2-(trifluoromethyl)anilino]butanoic acid (PubChem CID 126388147) has the molecular formula C27H22F3NO7 and a molecular weight of 529.47 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[(3-methylbenzoyl)oxy]-4-oxo-4-[2-(trifluoromethyl)anilino]butanoic acid.
| Compound Name | (2R,3R)-2,3-bis[(3-methylbenzoyl)oxy]-4-oxo-4-[2-(trifluoromethyl)anilino]butanoic acid |
|---|---|
| PubChem CID | 126388147 |
| Molecular Formula | C27H22F3NO7 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | (2R,3R)-2,3-bis[(3-methylbenzoyl)oxy]-4-oxo-4-[2-(trifluoromethyl)anilino]butanoic acid |
| SMILES | Cc1cccc(C(=O)O[C@@H](C(=O)O)[C@@H](OC(=O)c2cccc(C)c2)C(=O)Nc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C27H22F3NO7/c1-15-7-5-9-17(13-15)25(35)37-21(23(32)31-20-12-4-3-11-19(20)27(28,29)30)22(24(33)34)38-26(36)18-10-6-8-16(2)14-18/h3-14,21-22H,1-2H3,(H,31,32)(H,33,34)/t21-,22-/m1/s1 |
| InChIKey | XCHJWEQQVRMKMT-FGZHOGPDSA-N |
| XLogP | 4.80 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |