C28H27NO7 — CID 41301380
(2R,3S)-4-(3,4-dimethylanilino)-2,3-bis[(3-methylbenzoyl)oxy]-4-oxobutanoic acid (PubChem CID 41301380) has the molecular formula C28H27NO7 and a molecular weight of 489.52 g/mol. Its IUPAC name is (2R,3S)-4-(3,4-dimethylanilino)-2,3-bis[(3-methylbenzoyl)oxy]-4-oxobutanoic acid.
| Compound Name | (2R,3S)-4-(3,4-dimethylanilino)-2,3-bis[(3-methylbenzoyl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 41301380 |
| Molecular Formula | C28H27NO7 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | (2R,3S)-4-(3,4-dimethylanilino)-2,3-bis[(3-methylbenzoyl)oxy]-4-oxobutanoic acid |
| SMILES | Cc1cccc(C(=O)O[C@H](C(=O)Nc2ccc(C)c(C)c2)[C@@H](OC(=O)c2cccc(C)c2)C(=O)O)c1 |
| InChI | InChI=1S/C28H27NO7/c1-16-7-5-9-20(13-16)27(33)35-23(25(30)29-22-12-11-18(3)19(4)15-22)24(26(31)32)36-28(34)21-10-6-8-17(2)14-21/h5-15,23-24H,1-4H3,(H,29,30)(H,31,32)/t23-,24+/m0/s1 |
| InChIKey | MMMXCSLPKQNCAL-BJKOFHAPSA-N |
| XLogP | 4.39 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |