C27H25NO7 — CID 41302026
(2S,3R)-4-(3-methylanilino)-2,3-bis[(4-methylbenzoyl)oxy]-4-oxobutanoic acid (PubChem CID 41302026) has the molecular formula C27H25NO7 and a molecular weight of 475.50 g/mol. Its IUPAC name is (2S,3R)-4-(3-methylanilino)-2,3-bis[(4-methylbenzoyl)oxy]-4-oxobutanoic acid.
| Compound Name | (2S,3R)-4-(3-methylanilino)-2,3-bis[(4-methylbenzoyl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 41302026 |
| Molecular Formula | C27H25NO7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | (2S,3R)-4-(3-methylanilino)-2,3-bis[(4-methylbenzoyl)oxy]-4-oxobutanoic acid |
| SMILES | Cc1ccc(C(=O)O[C@H](C(=O)O)[C@@H](OC(=O)c2ccc(C)cc2)C(=O)Nc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C27H25NO7/c1-16-7-11-19(12-8-16)26(32)34-22(24(29)28-21-6-4-5-18(3)15-21)23(25(30)31)35-27(33)20-13-9-17(2)10-14-20/h4-15,22-23H,1-3H3,(H,28,29)(H,30,31)/t22-,23+/m1/s1 |
| InChIKey | AQOIMNBVWHHKNL-PKTZIBPZSA-N |
| XLogP | 4.09 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |