C27H25NO8 — CID 5221429
4-(4-methoxyanilino)-2,3-bis[(4-methylbenzoyl)oxy]-4-oxobutanoic acid (PubChem CID 5221429) has the molecular formula C27H25NO8 and a molecular weight of 491.50 g/mol. Its IUPAC name is 4-(4-methoxyanilino)-2,3-bis[(4-methylbenzoyl)oxy]-4-oxobutanoic acid.
| Compound Name | 4-(4-methoxyanilino)-2,3-bis[(4-methylbenzoyl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 5221429 |
| Molecular Formula | C27H25NO8 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 4-(4-methoxyanilino)-2,3-bis[(4-methylbenzoyl)oxy]-4-oxobutanoic acid |
| SMILES | COc1ccc(NC(=O)C(OC(=O)c2ccc(C)cc2)C(OC(=O)c2ccc(C)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C27H25NO8/c1-16-4-8-18(9-5-16)26(32)35-22(24(29)28-20-12-14-21(34-3)15-13-20)23(25(30)31)36-27(33)19-10-6-17(2)7-11-19/h4-15,22-23H,1-3H3,(H,28,29)(H,30,31) |
| InChIKey | SYFNQUGSQOMTLB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |