C27H24N2O9 — CID 126382528
(2R,3R)-2,3-bis[(3-methylbenzoyl)oxy]-4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid (PubChem CID 126382528) has the molecular formula C27H24N2O9 and a molecular weight of 520.49 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[(3-methylbenzoyl)oxy]-4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid.
| Compound Name | (2R,3R)-2,3-bis[(3-methylbenzoyl)oxy]-4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 126382528 |
| Molecular Formula | C27H24N2O9 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | (2R,3R)-2,3-bis[(3-methylbenzoyl)oxy]-4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid |
| SMILES | Cc1cccc(C(=O)O[C@@H](C(=O)O)[C@@H](OC(=O)c2cccc(C)c2)C(=O)Nc2cc([N+](=O)[O-])ccc2C)c1 |
| InChI | InChI=1S/C27H24N2O9/c1-15-6-4-8-18(12-15)26(33)37-22(24(30)28-21-14-20(29(35)36)11-10-17(21)3)23(25(31)32)38-27(34)19-9-5-7-16(2)13-19/h4-14,22-23H,1-3H3,(H,28,30)(H,31,32)/t22-,23-/m1/s1 |
| InChIKey | KWDHZSCTGVZZJP-DHIUTWEWSA-N |
| XLogP | 3.99 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|