C27H24N2O10 — CID 126379851
(2S,3S)-4-(2-methoxy-5-nitroanilino)-2,3-bis[(3-methylbenzoyl)oxy]-4-oxobutanoic acid (PubChem CID 126379851) has the molecular formula C27H24N2O10 and a molecular weight of 536.49 g/mol. Its IUPAC name is (2S,3S)-4-(2-methoxy-5-nitroanilino)-2,3-bis[(3-methylbenzoyl)oxy]-4-oxobutanoic acid.
| Compound Name | (2S,3S)-4-(2-methoxy-5-nitroanilino)-2,3-bis[(3-methylbenzoyl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 126379851 |
| Molecular Formula | C27H24N2O10 |
| Molecular Weight | 536.49 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | (2S,3S)-4-(2-methoxy-5-nitroanilino)-2,3-bis[(3-methylbenzoyl)oxy]-4-oxobutanoic acid |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H](OC(=O)c1cccc(C)c1)[C@H](OC(=O)c1cccc(C)c1)C(=O)O |
| InChI | InChI=1S/C27H24N2O10/c1-15-6-4-8-17(12-15)26(33)38-22(23(25(31)32)39-27(34)18-9-5-7-16(2)13-18)24(30)28-20-14-19(29(35)36)10-11-21(20)37-3/h4-14,22-23H,1-3H3,(H,28,30)(H,31,32)/t22-,23-/m0/s1 |
| InChIKey | HZJKKZQHMXIJEH-GOTSBHOMSA-N |
| XLogP | 3.69 |
| TPSA | 171.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|