C28H28N2O7 — CID 126380957
(2R,3S)-4-[4-(dimethylamino)anilino]-2,3-bis[(3-methylbenzoyl)oxy]-4-oxobutanoic acid (PubChem CID 126380957) has the molecular formula C28H28N2O7 and a molecular weight of 504.54 g/mol. Its IUPAC name is (2R,3S)-4-[4-(dimethylamino)anilino]-2,3-bis[(3-methylbenzoyl)oxy]-4-oxobutanoic acid.
| Compound Name | (2R,3S)-4-[4-(dimethylamino)anilino]-2,3-bis[(3-methylbenzoyl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 126380957 |
| Molecular Formula | C28H28N2O7 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | (2R,3S)-4-[4-(dimethylamino)anilino]-2,3-bis[(3-methylbenzoyl)oxy]-4-oxobutanoic acid |
| SMILES | Cc1cccc(C(=O)O[C@H](C(=O)Nc2ccc(N(C)C)cc2)[C@@H](OC(=O)c2cccc(C)c2)C(=O)O)c1 |
| InChI | InChI=1S/C28H28N2O7/c1-17-7-5-9-19(15-17)27(34)36-23(25(31)29-21-11-13-22(14-12-21)30(3)4)24(26(32)33)37-28(35)20-10-6-8-18(2)16-20/h5-16,23-24H,1-4H3,(H,29,31)(H,32,33)/t23-,24+/m0/s1 |
| InChIKey | AIFAAKAFTAFBOC-BJKOFHAPSA-N |
| XLogP | 3.84 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|