C34H28ClN3O9 — CID 126380917
(2R,3R)-4-[2-[4-[(4-chlorobenzoyl)amino]benzoyl]hydrazinyl]-2,3-bis[(3-methylbenzoyl)oxy]-4-oxobutanoic acid (PubChem CID 126380917) has the molecular formula C34H28ClN3O9 and a molecular weight of 658.06 g/mol. Its IUPAC name is (2R,3R)-4-[2-[4-[(4-chlorobenzoyl)amino]benzoyl]hydrazinyl]-2,3-bis[(3-methylbenzoyl)oxy]-4-oxobutanoic acid.
| Compound Name | (2R,3R)-4-[2-[4-[(4-chlorobenzoyl)amino]benzoyl]hydrazinyl]-2,3-bis[(3-methylbenzoyl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 126380917 |
| Molecular Formula | C34H28ClN3O9 |
| Molecular Weight | 658.06 g/mol |
| Exact Mass | 657.15 |
| IUPAC Name | (2R,3R)-4-[2-[4-[(4-chlorobenzoyl)amino]benzoyl]hydrazinyl]-2,3-bis[(3-methylbenzoyl)oxy]-4-oxobutanoic acid |
| SMILES | Cc1cccc(C(=O)O[C@@H](C(=O)O)[C@@H](OC(=O)c2cccc(C)c2)C(=O)NNC(=O)c2ccc(NC(=O)c3ccc(Cl)cc3)cc2)c1 |
| InChI | InChI=1S/C34H28ClN3O9/c1-19-5-3-7-23(17-19)33(44)46-27(28(32(42)43)47-34(45)24-8-4-6-20(2)18-24)31(41)38-37-30(40)22-11-15-26(16-12-22)36-29(39)21-9-13-25(35)14-10-21/h3-18,27-28H,1-2H3,(H,36,39)(H,37,40)(H,38,41)(H,42,43)/t27-,28-/m1/s1 |
| InChIKey | XDPMFVFOYBZMMK-VSGBNLITSA-N |
| XLogP | 4.51 |
| TPSA | 177.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.06 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|