C28H28N2O9 — CID 126391073
(2R,3S)-4-[4-(dimethylamino)anilino]-2,3-bis[(3-methoxybenzoyl)oxy]-4-oxobutanoic acid (PubChem CID 126391073) has the molecular formula C28H28N2O9 and a molecular weight of 536.54 g/mol. Its IUPAC name is (2R,3S)-4-[4-(dimethylamino)anilino]-2,3-bis[(3-methoxybenzoyl)oxy]-4-oxobutanoic acid.
| Compound Name | (2R,3S)-4-[4-(dimethylamino)anilino]-2,3-bis[(3-methoxybenzoyl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 126391073 |
| Molecular Formula | C28H28N2O9 |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | (2R,3S)-4-[4-(dimethylamino)anilino]-2,3-bis[(3-methoxybenzoyl)oxy]-4-oxobutanoic acid |
| SMILES | COc1cccc(C(=O)O[C@H](C(=O)Nc2ccc(N(C)C)cc2)[C@@H](OC(=O)c2cccc(OC)c2)C(=O)O)c1 |
| InChI | InChI=1S/C28H28N2O9/c1-30(2)20-13-11-19(12-14-20)29-25(31)23(38-27(34)17-7-5-9-21(15-17)36-3)24(26(32)33)39-28(35)18-8-6-10-22(16-18)37-4/h5-16,23-24H,1-4H3,(H,29,31)(H,32,33)/t23-,24+/m0/s1 |
| InChIKey | LZVZSICQKKKOGG-BJKOFHAPSA-N |
| XLogP | 3.24 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|