C32H27N3O9 — CID 126383571
(2S,3R)-2,3-bis[(3-methoxybenzoyl)oxy]-4-oxo-4-(4-phenyldiazenylanilino)butanoic acid (PubChem CID 126383571) has the molecular formula C32H27N3O9 and a molecular weight of 597.58 g/mol. Its IUPAC name is (2S,3R)-2,3-bis[(3-methoxybenzoyl)oxy]-4-oxo-4-(4-phenyldiazenylanilino)butanoic acid.
| Compound Name | (2S,3R)-2,3-bis[(3-methoxybenzoyl)oxy]-4-oxo-4-(4-phenyldiazenylanilino)butanoic acid |
|---|---|
| PubChem CID | 126383571 |
| Molecular Formula | C32H27N3O9 |
| Molecular Weight | 597.58 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | (2S,3R)-2,3-bis[(3-methoxybenzoyl)oxy]-4-oxo-4-(4-phenyldiazenylanilino)butanoic acid |
| SMILES | COc1cccc(C(=O)O[C@H](C(=O)O)[C@@H](OC(=O)c2cccc(OC)c2)C(=O)Nc2ccc(/N=N/c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C32H27N3O9/c1-41-25-12-6-8-20(18-25)31(39)43-27(28(30(37)38)44-32(40)21-9-7-13-26(19-21)42-2)29(36)33-22-14-16-24(17-15-22)35-34-23-10-4-3-5-11-23/h3-19,27-28H,1-2H3,(H,33,36)(H,37,38)/b35-34+/t27-,28+/m1/s1 |
| InChIKey | UAMHNKJAHRBDCK-GOGBUHCNSA-N |
| XLogP | 5.59 |
| TPSA | 162.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|