C32H21F6N3O7 — CID 126381276
(2S,3R)-4-oxo-4-(4-phenyldiazenylanilino)-2,3-bis[[3-(trifluoromethyl)benzoyl]oxy]butanoic acid (PubChem CID 126381276) has the molecular formula C32H21F6N3O7 and a molecular weight of 673.52 g/mol. Its IUPAC name is (2S,3R)-4-oxo-4-(4-phenyldiazenylanilino)-2,3-bis[[3-(trifluoromethyl)benzoyl]oxy]butanoic acid.
| Compound Name | (2S,3R)-4-oxo-4-(4-phenyldiazenylanilino)-2,3-bis[[3-(trifluoromethyl)benzoyl]oxy]butanoic acid |
|---|---|
| PubChem CID | 126381276 |
| Molecular Formula | C32H21F6N3O7 |
| Molecular Weight | 673.52 g/mol |
| Exact Mass | 673.13 |
| IUPAC Name | (2S,3R)-4-oxo-4-(4-phenyldiazenylanilino)-2,3-bis[[3-(trifluoromethyl)benzoyl]oxy]butanoic acid |
| SMILES | O=C(O[C@H](C(=O)O)[C@@H](OC(=O)c1cccc(C(F)(F)F)c1)C(=O)Nc1ccc(/N=N/c2ccccc2)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H21F6N3O7/c33-31(34,35)20-8-4-6-18(16-20)29(45)47-25(26(28(43)44)48-30(46)19-7-5-9-21(17-19)32(36,37)38)27(42)39-22-12-14-24(15-13-22)41-40-23-10-2-1-3-11-23/h1-17,25-26H,(H,39,42)(H,43,44)/b41-40+/t25-,26+/m1/s1 |
| InChIKey | CPNMOIGALAGBSJ-MHSPNTTJSA-N |
| XLogP | 7.61 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.52 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|