C21H15FN2O3 — CID 4279498
[(2-oxo-1,2-diphenylethylidene)amino] N-(4-fluorophenyl)carbamate (PubChem CID 4279498) has the molecular formula C21H15FN2O3 and a molecular weight of 362.36 g/mol. Its IUPAC name is [(2-oxo-1,2-diphenylethylidene)amino] N-(4-fluorophenyl)carbamate.
| Compound Name | [(2-oxo-1,2-diphenylethylidene)amino] N-(4-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 4279498 |
| Molecular Formula | C21H15FN2O3 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | [(2-oxo-1,2-diphenylethylidene)amino] N-(4-fluorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(F)cc1)ON=C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15FN2O3/c22-17-11-13-18(14-12-17)23-21(26)27-24-19(15-7-3-1-4-8-15)20(25)16-9-5-2-6-10-16/h1-14H,(H,23,26) |
| InChIKey | VGPFUGSZXMWZTE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|