C15H13FN4OS — CID 95240440
[(E)-[2-(4-fluoroanilino)-1-phenyl-2-sulfanylideneethylidene]amino]urea (PubChem CID 95240440) has the molecular formula C15H13FN4OS and a molecular weight of 316.36 g/mol. Its IUPAC name is [(E)-[2-(4-fluoroanilino)-1-phenyl-2-sulfanylideneethylidene]amino]urea.
| Compound Name | [(E)-[2-(4-fluoroanilino)-1-phenyl-2-sulfanylideneethylidene]amino]urea |
|---|---|
| PubChem CID | 95240440 |
| Molecular Formula | C15H13FN4OS |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | [(E)-[2-(4-fluoroanilino)-1-phenyl-2-sulfanylideneethylidene]amino]urea |
| SMILES | NC(=O)N/N=C(/C(=S)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C15H13FN4OS/c16-11-6-8-12(9-7-11)18-14(22)13(19-20-15(17)21)10-4-2-1-3-5-10/h1-9H,(H,18,22)(H3,17,20,21)/b19-13+ |
| InChIKey | QHAWMDWPWJRQJW-CPNJWEJPSA-N |
| XLogP | 2.64 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|