C21H16N2OS — CID 56697878
N-[(E)-(2-oxo-1,2-diphenylethylidene)amino]benzenecarbothioamide (PubChem CID 56697878) has the molecular formula C21H16N2OS and a molecular weight of 344.44 g/mol. Its IUPAC name is N-[(E)-(2-oxo-1,2-diphenylethylidene)amino]benzenecarbothioamide.
| Compound Name | N-[(E)-(2-oxo-1,2-diphenylethylidene)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 56697878 |
| Molecular Formula | C21H16N2OS |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-[(E)-(2-oxo-1,2-diphenylethylidene)amino]benzenecarbothioamide |
| SMILES | O=C(/C(=N/NC(=S)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16N2OS/c24-20(17-12-6-2-7-13-17)19(16-10-4-1-5-11-16)22-23-21(25)18-14-8-3-9-15-18/h1-15H,(H,23,25)/b22-19+ |
| InChIKey | YIDKLUJMWQDJSF-ZBJSNUHESA-N |
| XLogP | 4.24 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|