C16H16N2O — CID 73182544
2-(dimethylhydrazinylidene)-1,2-diphenylethanone (PubChem CID 73182544) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 2-(dimethylhydrazinylidene)-1,2-diphenylethanone.
| Compound Name | 2-(dimethylhydrazinylidene)-1,2-diphenylethanone |
|---|---|
| PubChem CID | 73182544 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-(dimethylhydrazinylidene)-1,2-diphenylethanone |
| SMILES | CN(C)N=C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O/c1-18(2)17-15(13-9-5-3-6-10-13)16(19)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | GTVTWEIMSRAUFO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|