C28H26N4 — CID 4287495
N-methyl-N-[[2-[methyl(phenyl)hydrazinylidene]-1,2-diphenylethylidene]amino]aniline (PubChem CID 4287495) has the molecular formula C28H26N4 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-methyl-N-[[2-[methyl(phenyl)hydrazinylidene]-1,2-diphenylethylidene]amino]aniline.
| Compound Name | N-methyl-N-[[2-[methyl(phenyl)hydrazinylidene]-1,2-diphenylethylidene]amino]aniline |
|---|---|
| PubChem CID | 4287495 |
| Molecular Formula | C28H26N4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | N-methyl-N-[[2-[methyl(phenyl)hydrazinylidene]-1,2-diphenylethylidene]amino]aniline |
| SMILES | CN(N=C(C(=NN(C)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H26N4/c1-31(25-19-11-5-12-20-25)29-27(23-15-7-3-8-16-23)28(24-17-9-4-10-18-24)30-32(2)26-21-13-6-14-22-26/h3-22H,1-2H3 |
| InChIKey | KGYUYHVERATBFZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|