About N-[(Z)-[(3Z)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]-N-methylaniline
N-[(Z)-[(3Z)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]-N-methylaniline (PubChem CID 6080786) has the molecular formula C24H26N6
and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[(Z)-[(3Z)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]-N-methylaniline.
Molecular Properties
| Compound Name | N-[(Z)-[(3Z)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]-N-methylaniline |
| PubChem CID | 6080786 |
| Molecular Formula | C24H26N6 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | N-[(Z)-[(3Z)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]-N-methylaniline |
| SMILES | CN(N=C(/C=N\N(C)c1ccccc1)/C=N\N(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26N6/c1-28(22-13-7-4-8-14-22)25-19-21(27-30(3)24-17-11-6-12-18-24)20-26-29(2)23-15-9-5-10-16-23/h4-20H,1-3H3/b25-19-,26-20- |
| InChIKey | LNTNHRWHOBVRQC-DQIQZUARSA-N |
| XLogP | 4.72 |
| TPSA | 46.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-[(3Z)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-[(3Z)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]-N-methylaniline?
The IUPAC name of N-[(Z)-[(3Z)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]-N-methylaniline (CID 6080786) is N-[(Z)-[(3Z)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]-N-methylaniline.
What is the SMILES notation for N-[(Z)-[(3Z)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]-N-methylaniline?
The canonical SMILES for N-[(Z)-[(3Z)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]-N-methylaniline is CN(N=C(/C=N\N(C)c1ccccc1)/C=N\N(C)c1ccccc1)c1ccccc1.
What is the InChIKey of N-[(Z)-[(3Z)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]-N-methylaniline?
The InChIKey is LNTNHRWHOBVRQC-DQIQZUARSA-N. The full InChI is InChI=1S/C24H26N6/c1-28(22-13-7-4-8-14-22)25-19-21(27-30(3)24-17-11-6-12-18-24)20-26-29(2)23-15-9-5-10-16-23/h4-20H,1-3H3/b25-19-,26-20-.
What are the key properties of N-[(Z)-[(3Z)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]-N-methylaniline?
N-[(Z)-[(3Z)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]-N-methylaniline has a molecular weight of 398.51 g/mol, XLogP of 4.72, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-[(3Z)-2,3-bis[methyl(phenyl)hydrazinylidene]propylidene]amino]-N-methylaniline is sourced from PubChem (CID 6080786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).