C10H9N2O3- — CID 25141038
(2E)-2-(acetylhydrazinylidene)-2-phenylacetate (PubChem CID 25141038) has the molecular formula C10H9N2O3- and a molecular weight of 205.19 g/mol. Its IUPAC name is (2E)-2-(acetylhydrazinylidene)-2-phenylacetate.
| Compound Name | (2E)-2-(acetylhydrazinylidene)-2-phenylacetate |
|---|---|
| PubChem CID | 25141038 |
| Molecular Formula | C10H9N2O3- |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | (2E)-2-(acetylhydrazinylidene)-2-phenylacetate |
| SMILES | CC(=O)N/N=C(/C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C10H10N2O3/c1-7(13)11-12-9(10(14)15)8-5-3-2-4-6-8/h2-6H,1H3,(H,11,13)(H,14,15)/p-1/b12-9+ |
| InChIKey | FINCVADLYATHML-FMIVXFBMSA-M |
| XLogP | -0.72 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|