C13H18N6O2S2 — CID 20836516
1-methylsulfanyl-3-[(Z)-[(1Z)-1-(methylsulfanylcarbamoylhydrazinylidene)-1-phenylpropan-2-ylidene]amino]urea (PubChem CID 20836516) has the molecular formula C13H18N6O2S2 and a molecular weight of 354.46 g/mol. Its IUPAC name is 1-methylsulfanyl-3-[(Z)-[(1Z)-1-(methylsulfanylcarbamoylhydrazinylidene)-1-phenylpropan-2-ylidene]amino]urea.
| Compound Name | 1-methylsulfanyl-3-[(Z)-[(1Z)-1-(methylsulfanylcarbamoylhydrazinylidene)-1-phenylpropan-2-ylidene]amino]urea |
|---|---|
| PubChem CID | 20836516 |
| Molecular Formula | C13H18N6O2S2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-methylsulfanyl-3-[(Z)-[(1Z)-1-(methylsulfanylcarbamoylhydrazinylidene)-1-phenylpropan-2-ylidene]amino]urea |
| SMILES | CSNC(=O)N/N=C(C)\C(=N/NC(=O)NSC)c1ccccc1 |
| InChI | InChI=1S/C13H18N6O2S2/c1-9(14-16-12(20)18-22-2)11(10-7-5-4-6-8-10)15-17-13(21)19-23-3/h4-8H,1-3H3,(H2,16,18,20)(H2,17,19,21)/b14-9-,15-11+ |
| InChIKey | JYPXCZPLVKXGKK-GNESMGCMSA-N |
| XLogP | 1.92 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|