C12H16N6O2 — CID 135052018
[(Z)-[(1Z)-1-(carbamoylhydrazinylidene)-1-(4-methylphenyl)propan-2-ylidene]amino]urea (PubChem CID 135052018) has the molecular formula C12H16N6O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is [(Z)-[(1Z)-1-(carbamoylhydrazinylidene)-1-(4-methylphenyl)propan-2-ylidene]amino]urea.
| Compound Name | [(Z)-[(1Z)-1-(carbamoylhydrazinylidene)-1-(4-methylphenyl)propan-2-ylidene]amino]urea |
|---|---|
| PubChem CID | 135052018 |
| Molecular Formula | C12H16N6O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | [(Z)-[(1Z)-1-(carbamoylhydrazinylidene)-1-(4-methylphenyl)propan-2-ylidene]amino]urea |
| SMILES | CC(=N/NC(N)=O)/C(=N\NC(N)=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H16N6O2/c1-7-3-5-9(6-4-7)10(16-18-12(14)20)8(2)15-17-11(13)19/h3-6H,1-2H3,(H3,13,17,19)(H3,14,18,20)/b15-8-,16-10+ |
| InChIKey | RAUVNGJUUPCGIF-JLZGHWJTSA-N |
| XLogP | 0.41 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|