C20H32N6S2 — CID 160778161
3-[[1-(diethylcarbamothioylhydrazinylidene)-1-(4-methylphenyl)propan-2-ylidene]amino]-1,1-diethylthiourea (PubChem CID 160778161) has the molecular formula C20H32N6S2 and a molecular weight of 420.65 g/mol. Its IUPAC name is 3-[[1-(diethylcarbamothioylhydrazinylidene)-1-(4-methylphenyl)propan-2-ylidene]amino]-1,1-diethylthiourea.
| Compound Name | 3-[[1-(diethylcarbamothioylhydrazinylidene)-1-(4-methylphenyl)propan-2-ylidene]amino]-1,1-diethylthiourea |
|---|---|
| PubChem CID | 160778161 |
| Molecular Formula | C20H32N6S2 |
| Molecular Weight | 420.65 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 3-[[1-(diethylcarbamothioylhydrazinylidene)-1-(4-methylphenyl)propan-2-ylidene]amino]-1,1-diethylthiourea |
| SMILES | CCN(CC)C(=S)NN=C(C)C(=NNC(=S)N(CC)CC)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H32N6S2/c1-7-25(8-2)19(27)23-21-16(6)18(17-13-11-15(5)12-14-17)22-24-20(28)26(9-3)10-4/h11-14H,7-10H2,1-6H3,(H,23,27)(H,24,28) |
| InChIKey | UFXQCMIHAWTKBC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.65 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|