C26H36N6OS2 — CID 147427246
3-[[2-(diethylcarbamothioylhydrazinylidene)-1-(4-ethoxyphenyl)-2-phenylethylidene]amino]-1,1-diethylthiourea (PubChem CID 147427246) has the molecular formula C26H36N6OS2 and a molecular weight of 512.75 g/mol. Its IUPAC name is 3-[[2-(diethylcarbamothioylhydrazinylidene)-1-(4-ethoxyphenyl)-2-phenylethylidene]amino]-1,1-diethylthiourea.
| Compound Name | 3-[[2-(diethylcarbamothioylhydrazinylidene)-1-(4-ethoxyphenyl)-2-phenylethylidene]amino]-1,1-diethylthiourea |
|---|---|
| PubChem CID | 147427246 |
| Molecular Formula | C26H36N6OS2 |
| Molecular Weight | 512.75 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 3-[[2-(diethylcarbamothioylhydrazinylidene)-1-(4-ethoxyphenyl)-2-phenylethylidene]amino]-1,1-diethylthiourea |
| SMILES | CCOc1ccc(C(=NNC(=S)N(CC)CC)C(=NNC(=S)N(CC)CC)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H36N6OS2/c1-6-31(7-2)25(34)29-27-23(20-14-12-11-13-15-20)24(28-30-26(35)32(8-3)9-4)21-16-18-22(19-17-21)33-10-5/h11-19H,6-10H2,1-5H3,(H,29,34)(H,30,35) |
| InChIKey | YFEZHAKWLGDDQW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 64.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.75 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|