C17H28N8S2 — CID 158465057
3-[[1-(diethylcarbamothioylhydrazinylidene)-1-pyrimidin-2-ylpropan-2-ylidene]amino]-1,1-diethylthiourea (PubChem CID 158465057) has the molecular formula C17H28N8S2 and a molecular weight of 408.60 g/mol. Its IUPAC name is 3-[[1-(diethylcarbamothioylhydrazinylidene)-1-pyrimidin-2-ylpropan-2-ylidene]amino]-1,1-diethylthiourea.
| Compound Name | 3-[[1-(diethylcarbamothioylhydrazinylidene)-1-pyrimidin-2-ylpropan-2-ylidene]amino]-1,1-diethylthiourea |
|---|---|
| PubChem CID | 158465057 |
| Molecular Formula | C17H28N8S2 |
| Molecular Weight | 408.60 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 3-[[1-(diethylcarbamothioylhydrazinylidene)-1-pyrimidin-2-ylpropan-2-ylidene]amino]-1,1-diethylthiourea |
| SMILES | CCN(CC)C(=S)NN=C(C)C(=NNC(=S)N(CC)CC)c1ncccn1 |
| InChI | InChI=1S/C17H28N8S2/c1-6-24(7-2)16(26)22-20-13(5)14(15-18-11-10-12-19-15)21-23-17(27)25(8-3)9-4/h10-12H,6-9H2,1-5H3,(H,22,26)(H,23,27) |
| InChIKey | AZPYWCRZQZBNNW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.60 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|