C12H19CuN4S+3 — CID 50909621
copper [N,N-diethyl-N'-(1-pyridin-2-ylethylideneamino)carbamimidoyl]sulfanium (PubChem CID 50909621) has the molecular formula C12H19CuN4S+3 and a molecular weight of 314.93 g/mol. Its IUPAC name is copper [N,N-diethyl-N'-(1-pyridin-2-ylethylideneamino)carbamimidoyl]sulfanium.
| Compound Name | copper [N,N-diethyl-N'-(1-pyridin-2-ylethylideneamino)carbamimidoyl]sulfanium |
|---|---|
| PubChem CID | 50909621 |
| Molecular Formula | C12H19CuN4S+3 |
| Molecular Weight | 314.93 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | copper [N,N-diethyl-N'-(1-pyridin-2-ylethylideneamino)carbamimidoyl]sulfanium |
| SMILES | CCN(CC)C([SH2+])=NN=C(C)c1ccccn1.[Cu+2] |
| InChI | InChI=1S/C12H18N4S.Cu/c1-4-16(5-2)12(17)15-14-10(3)11-8-6-7-9-13-11;/h6-9H,4-5H2,1-3H3,(H,15,17);/q;+2/p+1 |
| InChIKey | LNBOGCKDLMAYFH-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.93 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|