C24H38N8NiS2+4 — CID 5036858
bis([N,N-diethyl-N'-(1-pyridin-2-ylethylideneamino)carbamimidoyl]sulfanium);nickel(2+) (PubChem CID 5036858) has the molecular formula C24H38N8NiS2+4 and a molecular weight of 561.45 g/mol. Its IUPAC name is bis([N,N-diethyl-N'-(1-pyridin-2-ylethylideneamino)carbamimidoyl]sulfanium);nickel(2+).
| Compound Name | bis([N,N-diethyl-N'-(1-pyridin-2-ylethylideneamino)carbamimidoyl]sulfanium);nickel(2+) |
|---|---|
| PubChem CID | 5036858 |
| Molecular Formula | C24H38N8NiS2+4 |
| Molecular Weight | 561.45 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | bis([N,N-diethyl-N'-(1-pyridin-2-ylethylideneamino)carbamimidoyl]sulfanium);nickel(2+) |
| SMILES | CCN(CC)C([SH2+])=NN=C(C)c1ccccn1.CCN(CC)C([SH2+])=NN=C(C)c1ccccn1.[Ni+2] |
| InChI | InChI=1S/2C12H18N4S.Ni/c2*1-4-16(5-2)12(17)15-14-10(3)11-8-6-7-9-13-11;/h2*6-9H,4-5H2,1-3H3,(H,15,17);/q;;+2/p+2 |
| InChIKey | LAQJEXICUOCUOK-UHFFFAOYSA-P |
| XLogP | 3.03 |
| TPSA | 81.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|