C14H22CuN4S+2 — CID 3852051
copper [(dipropylamino)-sulfoniumylidenemethyl]-(1-pyridin-2-ylethylideneamino)azanide (PubChem CID 3852051) has the molecular formula C14H22CuN4S+2 and a molecular weight of 341.97 g/mol. Its IUPAC name is copper [(dipropylamino)-sulfoniumylidenemethyl]-(1-pyridin-2-ylethylideneamino)azanide.
| Compound Name | copper [(dipropylamino)-sulfoniumylidenemethyl]-(1-pyridin-2-ylethylideneamino)azanide |
|---|---|
| PubChem CID | 3852051 |
| Molecular Formula | C14H22CuN4S+2 |
| Molecular Weight | 341.97 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | copper [(dipropylamino)-sulfoniumylidenemethyl]-(1-pyridin-2-ylethylideneamino)azanide |
| SMILES | [Cu+2].[H]/[S+]=C(/[N-]N=C(C)c1ccccn1)N(CCC)CCC |
| InChI | InChI=1S/C14H22N4S.Cu/c1-4-10-18(11-5-2)14(19)17-16-12(3)13-8-6-7-9-15-13;/h6-9H,4-5,10-11H2,1-3H3,(H,15,17,19);/q;+2 |
| InChIKey | ZLTAOLQJQXNVSC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 42.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.97 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|