C14H14Br2N4SZn — CID 135502860
[anilino(sulfoniumylidene)methyl]-(1-pyridin-2-ylethylideneamino)azanide;dibromozinc (PubChem CID 135502860) has the molecular formula C14H14Br2N4SZn and a molecular weight of 495.56 g/mol. Its IUPAC name is [anilino(sulfoniumylidene)methyl]-(1-pyridin-2-ylethylideneamino)azanide;dibromozinc.
| Compound Name | [anilino(sulfoniumylidene)methyl]-(1-pyridin-2-ylethylideneamino)azanide;dibromozinc |
|---|---|
| PubChem CID | 135502860 |
| Molecular Formula | C14H14Br2N4SZn |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 491.86 |
| IUPAC Name | [anilino(sulfoniumylidene)methyl]-(1-pyridin-2-ylethylideneamino)azanide;dibromozinc |
| SMILES | Br[Zn]Br.[H]/[S+]=C(/[N-]N=C(C)c1ccccn1)Nc1ccccc1 |
| InChI | InChI=1S/C14H14N4S.2BrH.Zn/c1-11(13-9-5-6-10-15-13)17-18-14(19)16-12-7-3-2-4-8-12;;;/h2-10H,1H3,(H2,15,16,18,19);2*1H;/q;;;+2/p-2 |
| InChIKey | HBYGMVCNSNFJMT-UHFFFAOYSA-L |
| XLogP | 4.35 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|