C19H15CuN7S — CID 11626280
copper;phenylcarbamothioyl-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]azanide;azide (PubChem CID 11626280) has the molecular formula C19H15CuN7S and a molecular weight of 436.99 g/mol. Its IUPAC name is copper;phenylcarbamothioyl-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]azanide;azide.
| Compound Name | copper;phenylcarbamothioyl-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]azanide;azide |
|---|---|
| PubChem CID | 11626280 |
| Molecular Formula | C19H15CuN7S |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | copper;phenylcarbamothioyl-[(E)-[phenyl(pyridin-2-yl)methylidene]amino]azanide;azide |
| SMILES | S=C([N-]/N=C(\c1ccccc1)c1ccccn1)Nc1ccccc1.[Cu+2].[N-]=[N+]=[N-] |
| InChI | InChI=1S/C19H16N4S.Cu.N3/c24-19(21-16-11-5-2-6-12-16)23-22-18(15-9-3-1-4-10-15)17-13-7-8-14-20-17;;1-3-2/h1-14H,(H2,20,21,23,24);;/q;+2;-1/p-1 |
| InChIKey | NRPTWYLWJUKDRV-UHFFFAOYSA-M |
| XLogP | 5.47 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|