C15H16Cl2CuN4S — CID 3565596
dichlorocopper;[dimethylamino(sulfoniumylidene)methyl]-[[phenyl(pyridin-2-yl)methylidene]amino]azanide (PubChem CID 3565596) has the molecular formula C15H16Cl2CuN4S and a molecular weight of 418.84 g/mol. Its IUPAC name is dichlorocopper;[dimethylamino(sulfoniumylidene)methyl]-[[phenyl(pyridin-2-yl)methylidene]amino]azanide.
| Compound Name | dichlorocopper;[dimethylamino(sulfoniumylidene)methyl]-[[phenyl(pyridin-2-yl)methylidene]amino]azanide |
|---|---|
| PubChem CID | 3565596 |
| Molecular Formula | C15H16Cl2CuN4S |
| Molecular Weight | 418.84 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | dichlorocopper;[dimethylamino(sulfoniumylidene)methyl]-[[phenyl(pyridin-2-yl)methylidene]amino]azanide |
| SMILES | Cl[Cu]Cl.[H]/[S+]=C(/[N-]N=C(c1ccccc1)c1ccccn1)N(C)C |
| InChI | InChI=1S/C15H16N4S.2ClH.Cu/c1-19(2)15(20)18-17-14(12-8-4-3-5-9-12)13-10-6-7-11-16-13;;;/h3-11H,1-2H3,(H,16,18,20);2*1H;/q;;;+2/p-2 |
| InChIKey | GNFUXPGFBRVJAK-UHFFFAOYSA-L |
| XLogP | 3.51 |
| TPSA | 42.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.84 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|