C16H20GaN8S2+3 — CID 3746529
gallium bis([amino(sulfoniumylidene)methyl]-(1-pyridin-2-ylethylideneamino)azanide) (PubChem CID 3746529) has the molecular formula C16H20GaN8S2+3 and a molecular weight of 458.25 g/mol. Its IUPAC name is gallium bis([amino(sulfoniumylidene)methyl]-(1-pyridin-2-ylethylideneamino)azanide).
| Compound Name | gallium bis([amino(sulfoniumylidene)methyl]-(1-pyridin-2-ylethylideneamino)azanide) |
|---|---|
| PubChem CID | 3746529 |
| Molecular Formula | C16H20GaN8S2+3 |
| Molecular Weight | 458.25 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | gallium bis([amino(sulfoniumylidene)methyl]-(1-pyridin-2-ylethylideneamino)azanide) |
| SMILES | [Ga+3].[H]/[S+]=C(/N)[N-]N=C(C)c1ccccn1.[H]/[S+]=C(\N)[N-]N=C(C)c1ccccn1 |
| InChI | InChI=1S/2C8H10N4S.Ga/c2*1-6(11-12-8(9)13)7-4-2-3-5-10-7;/h2*2-5H,1H3,(H3,9,10,12,13);/q;;+3 |
| InChIKey | VSKIYCRODCWHEV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 130.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|