C14H20N7NiS- — CID 3433907
[azepan-1-yl(sulfoniumylidene)methyl]-(1-pyridin-2-ylethylideneamino)azanide;nickel;azide (PubChem CID 3433907) has the molecular formula C14H20N7NiS- and a molecular weight of 377.12 g/mol. Its IUPAC name is [azepan-1-yl(sulfoniumylidene)methyl]-(1-pyridin-2-ylethylideneamino)azanide;nickel;azide.
| Compound Name | [azepan-1-yl(sulfoniumylidene)methyl]-(1-pyridin-2-ylethylideneamino)azanide;nickel;azide |
|---|---|
| PubChem CID | 3433907 |
| Molecular Formula | C14H20N7NiS- |
| Molecular Weight | 377.12 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | [azepan-1-yl(sulfoniumylidene)methyl]-(1-pyridin-2-ylethylideneamino)azanide;nickel;azide |
| SMILES | [H]/[S+]=C(/[N-]N=C(C)c1ccccn1)N1CCCCCC1.[N-]=[N+]=[N-].[Ni] |
| InChI | InChI=1S/C14H20N4S.N3.Ni/c1-12(13-8-4-5-9-15-13)16-17-14(19)18-10-6-2-3-7-11-18;1-3-2;/h4-5,8-9H,2-3,6-7,10-11H2,1H3,(H,15,17,19);;/q;-1; |
| InChIKey | VGQQDIZPZPYBIT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.12 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|