C28H28N10NiS2 — CID 25193514
N'-(dipyridin-2-ylmethylideneamino)-N,N-dimethylcarbamimidothioate;N'-(dipyridin-2-ylmethylideneamino)-N,N-dimethylcarbamimidothioate;nickel(2+) (PubChem CID 25193514) has the molecular formula C28H28N10NiS2 and a molecular weight of 627.43 g/mol. Its IUPAC name is N'-(dipyridin-2-ylmethylideneamino)-N,N-dimethylcarbamimidothioate;N'-(dipyridin-2-ylmethylideneamino)-N,N-dimethylcarbamimidothioate;nickel(2+).
| Compound Name | N'-(dipyridin-2-ylmethylideneamino)-N,N-dimethylcarbamimidothioate;N'-(dipyridin-2-ylmethylideneamino)-N,N-dimethylcarbamimidothioate;nickel(2+) |
|---|---|
| PubChem CID | 25193514 |
| Molecular Formula | C28H28N10NiS2 |
| Molecular Weight | 627.43 g/mol |
| Exact Mass | 626.13 |
| IUPAC Name | N'-(dipyridin-2-ylmethylideneamino)-N,N-dimethylcarbamimidothioate;N'-(dipyridin-2-ylmethylideneamino)-N,N-dimethylcarbamimidothioate;nickel(2+) |
| SMILES | CN(C)/C([S-])=N/N=C(c1ccccn1)c1ccccn1.CN(C)/C([S-])=N\N=C(c1ccccn1)c1ccccn1.[Ni+2] |
| InChI | InChI=1S/2C14H15N5S.Ni/c2*1-19(2)14(20)18-17-13(11-7-3-5-9-15-11)12-8-4-6-10-16-12;/h2*3-10H,1-2H3,(H,18,20);/q;;+2/p-2 |
| InChIKey | SBAYGYGJAXULHG-UHFFFAOYSA-L |
| XLogP | 3.38 |
| TPSA | 107.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|