C16H19N5 — CID 139764297
2-[(Z)-[(4-propan-2-ylphenyl)-pyridin-2-ylmethylidene]amino]guanidine (PubChem CID 139764297) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-[(Z)-[(4-propan-2-ylphenyl)-pyridin-2-ylmethylidene]amino]guanidine.
| Compound Name | 2-[(Z)-[(4-propan-2-ylphenyl)-pyridin-2-ylmethylidene]amino]guanidine |
|---|---|
| PubChem CID | 139764297 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-[(Z)-[(4-propan-2-ylphenyl)-pyridin-2-ylmethylidene]amino]guanidine |
| SMILES | CC(C)c1ccc(/C(=N/N=C(N)N)c2ccccn2)cc1 |
| InChI | InChI=1S/C16H19N5/c1-11(2)12-6-8-13(9-7-12)15(20-21-16(17)18)14-5-3-4-10-19-14/h3-11H,1-2H3,(H4,17,18,21)/b20-15- |
| InChIKey | ZQLCWRNNEDNDTA-HKWRFOASSA-N |
| XLogP | 2.23 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|