C31H21N7O2-2 — CID 102083866
(N2Z,N6Z)-2-N,6-N-bis[phenyl(pyridin-2-yl)methylidene]pyridine-2,6-dicarbohydrazonate (PubChem CID 102083866) has the molecular formula C31H21N7O2-2 and a molecular weight of 523.56 g/mol. Its IUPAC name is (N2Z,N6Z)-2-N,6-N-bis[phenyl(pyridin-2-yl)methylidene]pyridine-2,6-dicarbohydrazonate.
| Compound Name | (N2Z,N6Z)-2-N,6-N-bis[phenyl(pyridin-2-yl)methylidene]pyridine-2,6-dicarbohydrazonate |
|---|---|
| PubChem CID | 102083866 |
| Molecular Formula | C31H21N7O2-2 |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | (N2Z,N6Z)-2-N,6-N-bis[phenyl(pyridin-2-yl)methylidene]pyridine-2,6-dicarbohydrazonate |
| SMILES | [O-]C(=N/N=C(/c1ccccc1)c1ccccn1)c1cccc(C([O-])=N/N=C(/c2ccccc2)c2ccccn2)n1 |
| InChI | InChI=1S/C31H23N7O2/c39-30(37-35-28(22-12-3-1-4-13-22)24-16-7-9-20-32-24)26-18-11-19-27(34-26)31(40)38-36-29(23-14-5-2-6-15-23)25-17-8-10-21-33-25/h1-21H,(H,37,39)(H,38,40)/p-2/b35-28-,36-29- |
| InChIKey | QCZUBVRFJRFXAF-UAHAWRDQSA-L |
| XLogP | 2.99 |
| TPSA | 134.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|