C11H16Cl2CuN4S — CID 3389171
dichlorocopper;[diethylamino(sulfoniumylidene)methyl]-(pyridin-2-ylmethylideneamino)azanide (PubChem CID 3389171) has the molecular formula C11H16Cl2CuN4S and a molecular weight of 370.80 g/mol. Its IUPAC name is dichlorocopper;[diethylamino(sulfoniumylidene)methyl]-(pyridin-2-ylmethylideneamino)azanide.
| Compound Name | dichlorocopper;[diethylamino(sulfoniumylidene)methyl]-(pyridin-2-ylmethylideneamino)azanide |
|---|---|
| PubChem CID | 3389171 |
| Molecular Formula | C11H16Cl2CuN4S |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | dichlorocopper;[diethylamino(sulfoniumylidene)methyl]-(pyridin-2-ylmethylideneamino)azanide |
| SMILES | Cl[Cu]Cl.[H]/[S+]=C(/[N-]N=Cc1ccccn1)N(CC)CC |
| InChI | InChI=1S/C11H16N4S.2ClH.Cu/c1-3-15(4-2)11(16)14-13-9-10-7-5-6-8-12-10;;;/h5-9H,3-4H2,1-2H3,(H,12,14,16);2*1H;/q;;;+2/p-2 |
| InChIKey | UQVWSYYXPISKTI-UHFFFAOYSA-L |
| XLogP | 2.87 |
| TPSA | 42.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|