C16H19CuN5S+2 — CID 5235739
copper [[methyl(2-pyridin-2-ylethyl)amino]-sulfoniumylidenemethyl]-[(6-methyl-2-pyridinyl)methylideneamino]azanide (PubChem CID 5235739) has the molecular formula C16H19CuN5S+2 and a molecular weight of 376.98 g/mol. Its IUPAC name is copper [[methyl(2-pyridin-2-ylethyl)amino]-sulfoniumylidenemethyl]-[(6-methyl-2-pyridinyl)methylideneamino]azanide.
| Compound Name | copper [[methyl(2-pyridin-2-ylethyl)amino]-sulfoniumylidenemethyl]-[(6-methyl-2-pyridinyl)methylideneamino]azanide |
|---|---|
| PubChem CID | 5235739 |
| Molecular Formula | C16H19CuN5S+2 |
| Molecular Weight | 376.98 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | copper [[methyl(2-pyridin-2-ylethyl)amino]-sulfoniumylidenemethyl]-[(6-methyl-2-pyridinyl)methylideneamino]azanide |
| SMILES | [Cu+2].[H]/[S+]=C(/[N-]N=Cc1cccc(C)n1)N(C)CCc1ccccn1 |
| InChI | InChI=1S/C16H19N5S.Cu/c1-13-6-5-8-15(19-13)12-18-20-16(22)21(2)11-9-14-7-3-4-10-17-14;/h3-8,10,12H,9,11H2,1-2H3,(H,19,20,22);/q;+2 |
| InChIKey | HHUMXZHUUMXYMN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.98 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|