C12H18Cl2CuN4S — CID 135413030
[butylamino(sulfoniumylidene)methyl]-[(6-methyl-2-pyridinyl)methylideneamino]azanide;dichlorocopper (PubChem CID 135413030) has the molecular formula C12H18Cl2CuN4S and a molecular weight of 384.82 g/mol. Its IUPAC name is [butylamino(sulfoniumylidene)methyl]-[(6-methyl-2-pyridinyl)methylideneamino]azanide;dichlorocopper.
| Compound Name | [butylamino(sulfoniumylidene)methyl]-[(6-methyl-2-pyridinyl)methylideneamino]azanide;dichlorocopper |
|---|---|
| PubChem CID | 135413030 |
| Molecular Formula | C12H18Cl2CuN4S |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | [butylamino(sulfoniumylidene)methyl]-[(6-methyl-2-pyridinyl)methylideneamino]azanide;dichlorocopper |
| SMILES | Cl[Cu]Cl.[H]/[S+]=C(/[N-]N=Cc1cccc(C)n1)NCCCC |
| InChI | InChI=1S/C12H18N4S.2ClH.Cu/c1-3-4-8-13-12(17)16-14-9-11-7-5-6-10(2)15-11;;;/h5-7,9H,3-4,8H2,1-2H3,(H2,13,15,16,17);2*1H;/q;;;+2/p-2 |
| InChIKey | HUNPQMPQMRHRLS-UHFFFAOYSA-L |
| XLogP | 3.23 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|