C14H13ClCuN3S2 — CID 3904172
[benzylsulfanyl(sulfoniumylidene)methyl]-(pyridin-2-ylmethylideneamino)azanide;chlorocopper (PubChem CID 3904172) has the molecular formula C14H13ClCuN3S2 and a molecular weight of 386.41 g/mol. Its IUPAC name is [benzylsulfanyl(sulfoniumylidene)methyl]-(pyridin-2-ylmethylideneamino)azanide;chlorocopper.
| Compound Name | [benzylsulfanyl(sulfoniumylidene)methyl]-(pyridin-2-ylmethylideneamino)azanide;chlorocopper |
|---|---|
| PubChem CID | 3904172 |
| Molecular Formula | C14H13ClCuN3S2 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 384.95 |
| IUPAC Name | [benzylsulfanyl(sulfoniumylidene)methyl]-(pyridin-2-ylmethylideneamino)azanide;chlorocopper |
| SMILES | Cl[Cu].[H]/[S+]=C(/[N-]N=Cc1ccccn1)SCc1ccccc1 |
| InChI | InChI=1S/C14H13N3S2.ClH.Cu/c18-14(19-11-12-6-2-1-3-7-12)17-16-10-13-8-4-5-9-15-13;;/h1-10H,11H2,(H,15,17,18);1H;/q;;+1/p-1 |
| InChIKey | LLCSJOHCWDJJPY-UHFFFAOYSA-M |
| XLogP | 3.78 |
| TPSA | 39.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|