About manganese(2+);pyridin-2-yl-(pyridin-2-ylmethylideneamino)azanide
manganese(2+);pyridin-2-yl-(pyridin-2-ylmethylideneamino)azanide (PubChem CID 3585581) has the molecular formula C11H9MnN4+
and a molecular weight of 252.16 g/mol. Its IUPAC name is manganese(2+);pyridin-2-yl-(pyridin-2-ylmethylideneamino)azanide.
Molecular Properties
| Compound Name | manganese(2+);pyridin-2-yl-(pyridin-2-ylmethylideneamino)azanide |
| PubChem CID | 3585581 |
| Molecular Formula | C11H9MnN4+ |
| Molecular Weight | 252.16 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | manganese(2+);pyridin-2-yl-(pyridin-2-ylmethylideneamino)azanide |
| SMILES | C(=N[N-]c1ccccn1)c1ccccn1.[Mn+2] |
| InChI | InChI=1S/C11H9N4.Mn/c1-3-7-12-10(5-1)9-14-15-11-6-2-4-8-13-11;/h1-9H;/q-1;+2 |
| InChIKey | YKDWXBVRYYNCHO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.16 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze manganese(2+);pyridin-2-yl-(pyridin-2-ylmethylideneamino)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+);pyridin-2-yl-(pyridin-2-ylmethylideneamino)azanide?
The IUPAC name of manganese(2+);pyridin-2-yl-(pyridin-2-ylmethylideneamino)azanide (CID 3585581) is manganese(2+);pyridin-2-yl-(pyridin-2-ylmethylideneamino)azanide.
What is the SMILES notation for manganese(2+);pyridin-2-yl-(pyridin-2-ylmethylideneamino)azanide?
The canonical SMILES for manganese(2+);pyridin-2-yl-(pyridin-2-ylmethylideneamino)azanide is C(=N[N-]c1ccccn1)c1ccccn1.[Mn+2].
What is the InChIKey of manganese(2+);pyridin-2-yl-(pyridin-2-ylmethylideneamino)azanide?
The InChIKey is YKDWXBVRYYNCHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N4.Mn/c1-3-7-12-10(5-1)9-14-15-11-6-2-4-8-13-11;/h1-9H;/q-1;+2.
What are the key properties of manganese(2+);pyridin-2-yl-(pyridin-2-ylmethylideneamino)azanide?
manganese(2+);pyridin-2-yl-(pyridin-2-ylmethylideneamino)azanide has a molecular weight of 252.16 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+);pyridin-2-yl-(pyridin-2-ylmethylideneamino)azanide is sourced from PubChem (CID 3585581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).