C28H26CuN6S4 — CID 3344493
bis([benzylsulfanyl(sulfoniumylidene)methyl]-(pyridin-2-ylmethylideneamino)azanide);copper (PubChem CID 3344493) has the molecular formula C28H26CuN6S4 and a molecular weight of 638.37 g/mol. Its IUPAC name is bis([benzylsulfanyl(sulfoniumylidene)methyl]-(pyridin-2-ylmethylideneamino)azanide);copper.
| Compound Name | bis([benzylsulfanyl(sulfoniumylidene)methyl]-(pyridin-2-ylmethylideneamino)azanide);copper |
|---|---|
| PubChem CID | 3344493 |
| Molecular Formula | C28H26CuN6S4 |
| Molecular Weight | 638.37 g/mol |
| Exact Mass | 637.04 |
| IUPAC Name | bis([benzylsulfanyl(sulfoniumylidene)methyl]-(pyridin-2-ylmethylideneamino)azanide);copper |
| SMILES | [Cu].[H]/[S+]=C(/[N-]N=Cc1ccccn1)SCc1ccccc1.[H]/[S+]=C(/[N-]N=Cc1ccccn1)SCc1ccccc1 |
| InChI | InChI=1S/2C14H13N3S2.Cu/c2*18-14(19-11-12-6-2-1-3-7-12)17-16-10-13-8-4-5-9-15-13;/h2*1-10H,11H2,(H,15,17,18); |
| InChIKey | NGZIBYXNJZUJIZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 78.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.37 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|