C17H25N5O2S2 — CID 132595682
2-N,6-N-bis(diethylcarbamothioyl)pyridine-2,6-dicarboxamide (PubChem CID 132595682) has the molecular formula C17H25N5O2S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 2-N,6-N-bis(diethylcarbamothioyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(diethylcarbamothioyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 132595682 |
| Molecular Formula | C17H25N5O2S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2-N,6-N-bis(diethylcarbamothioyl)pyridine-2,6-dicarboxamide |
| SMILES | CCN(CC)C(=S)NC(=O)c1cccc(C(=O)NC(=S)N(CC)CC)n1 |
| InChI | InChI=1S/C17H25N5O2S2/c1-5-21(6-2)16(25)19-14(23)12-10-9-11-13(18-12)15(24)20-17(26)22(7-3)8-4/h9-11H,5-8H2,1-4H3,(H,19,23,25)(H,20,24,26) |
| InChIKey | WICNAZQAIGNDSX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|