C34H50N10O8 — CID 139129379
2-N,6-N-bis(butylcarbamoyl)pyridine-2,6-dicarboxamide (PubChem CID 139129379) has the molecular formula C34H50N10O8 and a molecular weight of 726.84 g/mol. Its IUPAC name is 2-N,6-N-bis(butylcarbamoyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(butylcarbamoyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 139129379 |
| Molecular Formula | C34H50N10O8 |
| Molecular Weight | 726.84 g/mol |
| Exact Mass | 726.38 |
| IUPAC Name | 2-N,6-N-bis(butylcarbamoyl)pyridine-2,6-dicarboxamide |
| SMILES | CCCCNC(=O)NC(=O)c1cccc(C(=O)NC(=O)NCCCC)n1.CCCCNC(=O)NC(=O)c1cccc(C(=O)NC(=O)NCCCC)n1 |
| InChI | InChI=1S/2C17H25N5O4/c2*1-3-5-10-18-16(25)21-14(23)12-8-7-9-13(20-12)15(24)22-17(26)19-11-6-4-2/h2*7-9H,3-6,10-11H2,1-2H3,(H2,18,21,23,25)(H2,19,22,24,26) |
| InChIKey | HQRHVEMBJINDRL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 258.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.84 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|