C27H45Cl2N7O4 — CID 102508949
2-N,6-N-bis[5-(butylcarbamoylamino)-1-chloropentan-2-yl]pyridine-2,6-dicarboxamide (PubChem CID 102508949) has the molecular formula C27H45Cl2N7O4 and a molecular weight of 602.61 g/mol. Its IUPAC name is 2-N,6-N-bis[5-(butylcarbamoylamino)-1-chloropentan-2-yl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[5-(butylcarbamoylamino)-1-chloropentan-2-yl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 102508949 |
| Molecular Formula | C27H45Cl2N7O4 |
| Molecular Weight | 602.61 g/mol |
| Exact Mass | 601.29 |
| IUPAC Name | 2-N,6-N-bis[5-(butylcarbamoylamino)-1-chloropentan-2-yl]pyridine-2,6-dicarboxamide |
| SMILES | CCCCNC(=O)NCCCC(CCl)NC(=O)c1cccc(C(=O)NC(CCl)CCCNC(=O)NCCCC)n1 |
| InChI | InChI=1S/C27H45Cl2N7O4/c1-3-5-14-30-26(39)32-16-8-10-20(18-28)34-24(37)22-12-7-13-23(36-22)25(38)35-21(19-29)11-9-17-33-27(40)31-15-6-4-2/h7,12-13,20-21H,3-6,8-11,14-19H2,1-2H3,(H,34,37)(H,35,38)(H2,30,32,39)(H2,31,33,40) |
| InChIKey | QCNLFUAIXNNUGC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.61 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|