C11H17N5S — CID 155804403
3-[(E)-1-(3-ethylpyrazin-2-yl)ethylideneamino]-1,1-dimethylthiourea (PubChem CID 155804403) has the molecular formula C11H17N5S and a molecular weight of 251.36 g/mol. Its IUPAC name is 3-[(E)-1-(3-ethylpyrazin-2-yl)ethylideneamino]-1,1-dimethylthiourea.
| Compound Name | 3-[(E)-1-(3-ethylpyrazin-2-yl)ethylideneamino]-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 155804403 |
| Molecular Formula | C11H17N5S |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3-[(E)-1-(3-ethylpyrazin-2-yl)ethylideneamino]-1,1-dimethylthiourea |
| SMILES | CCc1nccnc1/C(C)=N/NC(=S)N(C)C |
| InChI | InChI=1S/C11H17N5S/c1-5-9-10(13-7-6-12-9)8(2)14-15-11(17)16(3)4/h6-7H,5H2,1-4H3,(H,15,17)/b14-8+ |
| InChIKey | BVAGAVVALZOQNX-RIYZIHGNSA-N |
| XLogP | 1.20 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|