C17H23GaN7O2S2+3 — CID 71492936
gallium 3-[(Z)-[1-[6-[(Z)-C-acetyl-N-(dimethylcarbamothioylamino)carbonimidoyl]-2-pyridinyl]-2-oxopropylidene]amino]-1,1-dimethylthiourea (PubChem CID 71492936) has the molecular formula C17H23GaN7O2S2+3 and a molecular weight of 491.28 g/mol. Its IUPAC name is gallium 3-[(Z)-[1-[6-[(Z)-C-acetyl-N-(dimethylcarbamothioylamino)carbonimidoyl]-2-pyridinyl]-2-oxopropylidene]amino]-1,1-dimethylthiourea.
| Compound Name | gallium 3-[(Z)-[1-[6-[(Z)-C-acetyl-N-(dimethylcarbamothioylamino)carbonimidoyl]-2-pyridinyl]-2-oxopropylidene]amino]-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 71492936 |
| Molecular Formula | C17H23GaN7O2S2+3 |
| Molecular Weight | 491.28 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | gallium 3-[(Z)-[1-[6-[(Z)-C-acetyl-N-(dimethylcarbamothioylamino)carbonimidoyl]-2-pyridinyl]-2-oxopropylidene]amino]-1,1-dimethylthiourea |
| SMILES | CC(=O)/C(=N\NC(=S)N(C)C)c1cccc(/C(=N/NC(=S)N(C)C)C(C)=O)n1.[Ga+3] |
| InChI | InChI=1S/C17H23N7O2S2.Ga/c1-10(25)14(19-21-16(27)23(3)4)12-8-7-9-13(18-12)15(11(2)26)20-22-17(28)24(5)6;/h7-9H,1-6H3,(H,21,27)(H,22,28);/q;+3/b19-14+,20-15+; |
| InChIKey | AFRKWKTTWUVJJU-DEFBRMOASA-N |
| XLogP | 0.16 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|