C31H37N5O2 — CID 15787905
4-tert-butyl-N-[(E)-1-[6-[(E)-N-[(4-tert-butylbenzoyl)amino]-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]benzamide (PubChem CID 15787905) has the molecular formula C31H37N5O2 and a molecular weight of 511.67 g/mol. Its IUPAC name is 4-tert-butyl-N-[(E)-1-[6-[(E)-N-[(4-tert-butylbenzoyl)amino]-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]benzamide.
| Compound Name | 4-tert-butyl-N-[(E)-1-[6-[(E)-N-[(4-tert-butylbenzoyl)amino]-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 15787905 |
| Molecular Formula | C31H37N5O2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | 4-tert-butyl-N-[(E)-1-[6-[(E)-N-[(4-tert-butylbenzoyl)amino]-C-methylcarbonimidoyl]-2-pyridinyl]ethylideneamino]benzamide |
| SMILES | C/C(=N\NC(=O)c1ccc(C(C)(C)C)cc1)c1cccc(/C(C)=N/NC(=O)c2ccc(C(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C31H37N5O2/c1-20(33-35-28(37)22-12-16-24(17-13-22)30(3,4)5)26-10-9-11-27(32-26)21(2)34-36-29(38)23-14-18-25(19-15-23)31(6,7)8/h9-19H,1-8H3,(H,35,37)(H,36,38)/b33-20+,34-21+ |
| InChIKey | CBMRZDZBUSVFAE-ZLINXINUSA-N |
| XLogP | 5.98 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|