C29H29N3OS — CID 5045046
N-[1-(4-tert-butylphenyl)ethylideneamino]-4-(quinolin-8-ylsulfanylmethyl)benzamide (PubChem CID 5045046) has the molecular formula C29H29N3OS and a molecular weight of 467.64 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)ethylideneamino]-4-(quinolin-8-ylsulfanylmethyl)benzamide.
| Compound Name | N-[1-(4-tert-butylphenyl)ethylideneamino]-4-(quinolin-8-ylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 5045046 |
| Molecular Formula | C29H29N3OS |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)ethylideneamino]-4-(quinolin-8-ylsulfanylmethyl)benzamide |
| SMILES | CC(=NNC(=O)c1ccc(CSc2cccc3cccnc23)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H29N3OS/c1-20(22-14-16-25(17-15-22)29(2,3)4)31-32-28(33)24-12-10-21(11-13-24)19-34-26-9-5-7-23-8-6-18-30-27(23)26/h5-18H,19H2,1-4H3,(H,32,33) |
| InChIKey | OUUZUVSFBLSWRN-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|