C22H21ClN4OS — CID 22830939
N-[(E)-1-(3-chlorophenyl)ethylideneamino]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzamide (PubChem CID 22830939) has the molecular formula C22H21ClN4OS and a molecular weight of 424.96 g/mol. Its IUPAC name is N-[(E)-1-(3-chlorophenyl)ethylideneamino]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzamide.
| Compound Name | N-[(E)-1-(3-chlorophenyl)ethylideneamino]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 22830939 |
| Molecular Formula | C22H21ClN4OS |
| Molecular Weight | 424.96 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | N-[(E)-1-(3-chlorophenyl)ethylideneamino]-4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzamide |
| SMILES | C/C(=N\NC(=O)c1ccc(CSc2nc(C)cc(C)n2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H21ClN4OS/c1-14-11-15(2)25-22(24-14)29-13-17-7-9-18(10-8-17)21(28)27-26-16(3)19-5-4-6-20(23)12-19/h4-12H,13H2,1-3H3,(H,27,28)/b26-16+ |
| InChIKey | HYTYSJYMAACISR-WGOQTCKBSA-N |
| XLogP | 5.19 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.96 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|